C28H23F3N6O2S2 — CID 23800975
2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 23800975) has the molecular formula C28H23F3N6O2S2 and a molecular weight of 596.66 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 23800975 |
| Molecular Formula | C28H23F3N6O2S2 |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1nnc(SCC(=O)Nc3ccc(F)cc3F)s1)C(N)=C(C#N)C2c1ccc(F)cc1 |
| InChI | InChI=1S/C28H23F3N6O2S2/c1-28(2)10-20-24(21(38)11-28)23(14-3-5-15(29)6-4-14)17(12-32)25(33)37(20)26-35-36-27(41-26)40-13-22(39)34-19-8-7-16(30)9-18(19)31/h3-9,23H,10-11,13,33H2,1-2H3,(H,34,39) |
| InChIKey | GVUCGZCODHHDBC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |