C30H29ClN6O2S2 — CID 23771780
2-[[5-[2-amino-4-(2-chlorophenyl)-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 23771780) has the molecular formula C30H29ClN6O2S2 and a molecular weight of 605.19 g/mol. Its IUPAC name is 2-[[5-[2-amino-4-(2-chlorophenyl)-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-4-(2-chlorophenyl)-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23771780 |
| Molecular Formula | C30H29ClN6O2S2 |
| Molecular Weight | 605.19 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 2-[[5-[2-amino-4-(2-chlorophenyl)-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSc2nnc(N3C(N)=C(C#N)C(c4ccccc4Cl)C4=C3CC(C)(C)CC4=O)s2)c1C |
| InChI | InChI=1S/C30H29ClN6O2S2/c1-16-8-7-11-21(17(16)2)34-24(39)15-40-29-36-35-28(41-29)37-22-12-30(3,4)13-23(38)26(22)25(19(14-32)27(37)33)18-9-5-6-10-20(18)31/h5-11,25H,12-13,15,33H2,1-4H3,(H,34,39) |
| InChIKey | SHAJKPHBYXDWHR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.19 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |