C29H26Cl2N6O3S2 — CID 23969921
2-[[5-[2-amino-3-cyano-4-(2,3-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide (PubChem CID 23969921) has the molecular formula C29H26Cl2N6O3S2 and a molecular weight of 641.61 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2,3-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2,3-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23969921 |
| Molecular Formula | C29H26Cl2N6O3S2 |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 640.09 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2,3-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CSc2nnc(N3C(N)=C(C#N)C(c4cccc(Cl)c4Cl)C4=C3CC(C)(C)CC4=O)s2)c1 |
| InChI | InChI=1S/C29H26Cl2N6O3S2/c1-29(2)11-20-24(21(38)12-29)23(17-8-5-9-19(30)25(17)31)18(13-32)26(33)37(20)27-35-36-28(42-27)41-14-22(39)34-15-6-4-7-16(10-15)40-3/h4-10,23H,11-12,14,33H2,1-3H3,(H,34,39) |
| InChIKey | XIVRQUSYTGSWKC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |