C28H23N7O2S2 — CID 23829684
2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-cyanophenyl)acetamide (PubChem CID 23829684) has the molecular formula C28H23N7O2S2 and a molecular weight of 553.67 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-cyanophenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 23829684 |
| Molecular Formula | C28H23N7O2S2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-cyanophenyl)acetamide |
| SMILES | Cc1ccccc1C1C(C#N)=C(N)N(c2nnc(SCC(=O)Nc3ccccc3C#N)s2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C28H23N7O2S2/c1-16-7-2-4-9-18(16)24-19(14-30)26(31)35(21-11-6-12-22(36)25(21)24)27-33-34-28(39-27)38-15-23(37)32-20-10-5-3-8-17(20)13-29/h2-5,7-10,24H,6,11-12,15,31H2,1H3,(H,32,37) |
| InChIKey | OYURSKUSZXVAFG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |