C30H30N6O5S2 — CID 23969865
2-[[5-[2-amino-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide (PubChem CID 23969865) has the molecular formula C30H30N6O5S2 and a molecular weight of 618.74 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 23969865 |
| Molecular Formula | C30H30N6O5S2 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccccc4C)s3)C3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C30H30N6O5S2/c1-16-8-5-6-9-19(16)33-24(38)15-42-30-35-34-29(43-30)36-20-10-7-11-21(37)26(20)25(18(14-31)28(36)32)17-12-22(39-2)27(41-4)23(13-17)40-3/h5-6,8-9,12-13,25H,7,10-11,15,32H2,1-4H3,(H,33,38) |
| InChIKey | SKFYFFADRGBICR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |