C23H22N6O4S2 — CID 23742504
2-amino-1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 23742504) has the molecular formula C23H22N6O4S2 and a molecular weight of 510.60 g/mol. Its IUPAC name is 2-amino-1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23742504 |
| Molecular Formula | C23H22N6O4S2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-amino-1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | COc1cc(C2C(C#N)=C(N)N(c3nnc(SCC#N)s3)C3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N6O4S2/c1-31-16-9-12(10-17(32-2)20(16)33-3)18-13(11-25)21(26)29(14-5-4-6-15(30)19(14)18)22-27-28-23(35-22)34-8-7-24/h9-10,18H,4-6,8,26H2,1-3H3 |
| InChIKey | HFJCUXFZRFGLJQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |