C29H28N6O4S2 — CID 23997587
2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide (PubChem CID 23997587) has the molecular formula C29H28N6O4S2 and a molecular weight of 588.72 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 23997587 |
| Molecular Formula | C29H28N6O4S2 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccccc4C)s3)C3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C29H28N6O4S2/c1-16-7-4-5-8-19(16)32-24(37)15-40-29-34-33-28(41-29)35-20-9-6-10-21(36)26(20)25(18(14-30)27(35)31)17-11-12-22(38-2)23(13-17)39-3/h4-5,7-8,11-13,25H,6,9-10,15,31H2,1-3H3,(H,32,37) |
| InChIKey | BGEUBPBHLCICHD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |