C27H23FN6O3S2 — CID 23941837
2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide (PubChem CID 23941837) has the molecular formula C27H23FN6O3S2 and a molecular weight of 562.65 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23941837 |
| Molecular Formula | C27H23FN6O3S2 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CSc1nnc(N2C(N)=C(C#N)C(c3ccc(F)cc3)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C27H23FN6O3S2/c1-37-21-8-3-2-5-18(21)31-22(36)14-38-27-33-32-26(39-27)34-19-6-4-7-20(35)24(19)23(17(13-29)25(34)30)15-9-11-16(28)12-10-15/h2-3,5,8-12,23H,4,6-7,14,30H2,1H3,(H,31,36) |
| InChIKey | XWJRUTWSXPBHJA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |