C26H21FN6O2S2 — CID 23742521
2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide (PubChem CID 23742521) has the molecular formula C26H21FN6O2S2 and a molecular weight of 532.63 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 23742521 |
| Molecular Formula | C26H21FN6O2S2 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(4-fluorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide |
| SMILES | N#CC1=C(N)N(c2nnc(SCC(=O)Nc3ccccc3)s2)C2=C(C(=O)CCC2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21FN6O2S2/c27-16-11-9-15(10-12-16)22-18(13-28)24(29)33(19-7-4-8-20(34)23(19)22)25-31-32-26(37-25)36-14-21(35)30-17-5-2-1-3-6-17/h1-3,5-6,9-12,22H,4,7-8,14,29H2,(H,30,35) |
| InChIKey | PYPVXULGXVMQDV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |