C29H26N6O4S2 — CID 23941889
methyl 4-[2-amino-3-cyano-1-[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate (PubChem CID 23941889) has the molecular formula C29H26N6O4S2 and a molecular weight of 586.70 g/mol. Its IUPAC name is methyl 4-[2-amino-3-cyano-1-[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate.
| Compound Name | methyl 4-[2-amino-3-cyano-1-[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 23941889 |
| Molecular Formula | C29H26N6O4S2 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | methyl 4-[2-amino-3-cyano-1-[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccc(C)cc4)s3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C29H26N6O4S2/c1-16-6-12-19(13-7-16)32-23(37)15-40-29-34-33-28(41-29)35-21-4-3-5-22(36)25(21)24(20(14-30)26(35)31)17-8-10-18(11-9-17)27(38)39-2/h6-13,24H,3-5,15,31H2,1-2H3,(H,32,37) |
| InChIKey | GKHQRTYKVJBQBB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |