C28H23FN6O4S2 — CID 23742598
methyl 4-[2-amino-3-cyano-1-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate (PubChem CID 23742598) has the molecular formula C28H23FN6O4S2 and a molecular weight of 590.66 g/mol. Its IUPAC name is methyl 4-[2-amino-3-cyano-1-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate.
| Compound Name | methyl 4-[2-amino-3-cyano-1-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 23742598 |
| Molecular Formula | C28H23FN6O4S2 |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | methyl 4-[2-amino-3-cyano-1-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-4,6,7,8-tetrahydroquinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccc(F)cc4)s3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C28H23FN6O4S2/c1-39-26(38)16-7-5-15(6-8-16)23-19(13-30)25(31)35(20-3-2-4-21(36)24(20)23)27-33-34-28(41-27)40-14-22(37)32-18-11-9-17(29)10-12-18/h5-12,23H,2-4,14,31H2,1H3,(H,32,37) |
| InChIKey | AMLXRYZUISYVQM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |