C29H28N6O2S2 — CID 23997521
2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 23997521) has the molecular formula C29H28N6O2S2 and a molecular weight of 556.72 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23997521 |
| Molecular Formula | C29H28N6O2S2 |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccc(C)c(C)c4)s3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C29H28N6O2S2/c1-16-7-10-19(11-8-16)25-21(14-30)27(31)35(22-5-4-6-23(36)26(22)25)28-33-34-29(39-28)38-15-24(37)32-20-12-9-17(2)18(3)13-20/h7-13,25H,4-6,15,31H2,1-3H3,(H,32,37) |
| InChIKey | DBGLBSOWVUGLTR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |