C27H20Cl2N6O4S2 — CID 23829827
4-[[2-[[5-[2-amino-3-cyano-4-(3,4-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid (PubChem CID 23829827) has the molecular formula C27H20Cl2N6O4S2 and a molecular weight of 627.54 g/mol. Its IUPAC name is 4-[[2-[[5-[2-amino-3-cyano-4-(3,4-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[5-[2-amino-3-cyano-4-(3,4-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23829827 |
| Molecular Formula | C27H20Cl2N6O4S2 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 4-[[2-[[5-[2-amino-3-cyano-4-(3,4-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid |
| SMILES | N#CC1=C(N)N(c2nnc(SCC(=O)Nc3ccc(C(=O)O)cc3)s2)C2=C(C(=O)CCC2)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H20Cl2N6O4S2/c28-17-9-6-14(10-18(17)29)22-16(11-30)24(31)35(19-2-1-3-20(36)23(19)22)26-33-34-27(41-26)40-12-21(37)32-15-7-4-13(5-8-15)25(38)39/h4-10,22H,1-3,12,31H2,(H,32,37)(H,38,39) |
| InChIKey | FOFVHWCMPGTSLZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |