C28H23ClN6O4S2 — CID 23941949
5-[[2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-2-chlorobenzoic acid (PubChem CID 23941949) has the molecular formula C28H23ClN6O4S2 and a molecular weight of 607.12 g/mol. Its IUPAC name is 5-[[2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 23941949 |
| Molecular Formula | C28H23ClN6O4S2 |
| Molecular Weight | 607.12 g/mol |
| Exact Mass | 606.09 |
| IUPAC Name | 5-[[2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-2-chlorobenzoic acid |
| SMILES | Cc1ccccc1C1C(C#N)=C(N)N(c2nnc(SCC(=O)Nc3ccc(Cl)c(C(=O)O)c3)s2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C28H23ClN6O4S2/c1-14-5-2-3-6-16(14)23-18(12-30)25(31)35(20-7-4-8-21(36)24(20)23)27-33-34-28(41-27)40-13-22(37)32-15-9-10-19(29)17(11-15)26(38)39/h2-3,5-6,9-11,23H,4,7-8,13,31H2,1H3,(H,32,37)(H,38,39) |
| InChIKey | MBBFVBRFDSZTET-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.12 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |