C27H23ClN6O2S2 — CID 23913849
2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide (PubChem CID 23913849) has the molecular formula C27H23ClN6O2S2 and a molecular weight of 563.11 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 23913849 |
| Molecular Formula | C27H23ClN6O2S2 |
| Molecular Weight | 563.11 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
| SMILES | Cc1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccc(Cl)cc4)s3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C27H23ClN6O2S2/c1-15-5-7-16(8-6-15)23-19(13-29)25(30)34(20-3-2-4-21(35)24(20)23)26-32-33-27(38-26)37-14-22(36)31-18-11-9-17(28)10-12-18/h5-12,23H,2-4,14,30H2,1H3,(H,31,36) |
| InChIKey | AYZBVXAQGGBTRG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.11 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |