C27H24ClN7O2S2 — CID 23913887
2-[[5-[2-amino-3-cyano-4-(4-ethylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-pyridinyl)acetamide (PubChem CID 23913887) has the molecular formula C27H24ClN7O2S2 and a molecular weight of 578.12 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(4-ethylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-pyridinyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(4-ethylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 23913887 |
| Molecular Formula | C27H24ClN7O2S2 |
| Molecular Weight | 578.12 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(4-ethylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-pyridinyl)acetamide |
| SMILES | CCc1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccc(Cl)cn4)s3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C27H24ClN7O2S2/c1-2-15-6-8-16(9-7-15)23-18(12-29)25(30)35(19-4-3-5-20(36)24(19)23)26-33-34-27(39-26)38-14-22(37)32-21-11-10-17(28)13-31-21/h6-11,13,23H,2-5,14,30H2,1H3,(H,31,32,37) |
| InChIKey | NPCRYMJEGMSRKH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.12 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |