C25H19Cl2N7O2S2 — CID 23800945
2-[[5-[2-amino-4-(4-chlorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 23800945) has the molecular formula C25H19Cl2N7O2S2 and a molecular weight of 584.51 g/mol. Its IUPAC name is 2-[[5-[2-amino-4-(4-chlorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[[5-[2-amino-4-(4-chlorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 23800945 |
| Molecular Formula | C25H19Cl2N7O2S2 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | 2-[[5-[2-amino-4-(4-chlorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | N#CC1=C(N)N(c2nnc(SCC(=O)Nc3cccnc3Cl)s2)C2=C(C(=O)CCC2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19Cl2N7O2S2/c26-14-8-6-13(7-9-14)20-15(11-28)23(29)34(17-4-1-5-18(35)21(17)20)24-32-33-25(38-24)37-12-19(36)31-16-3-2-10-30-22(16)27/h2-3,6-10,20H,1,4-5,12,29H2,(H,31,36) |
| InChIKey | BJOFRWTVOKZYTJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|