C27H24ClN7O4S2 — CID 23941960
2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 23941960) has the molecular formula C27H24ClN7O4S2 and a molecular weight of 610.12 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 23941960 |
| Molecular Formula | C27H24ClN7O4S2 |
| Molecular Weight | 610.12 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | COc1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4cccnc4Cl)s3)C3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C27H24ClN7O4S2/c1-38-19-9-8-14(11-20(19)39-2)22-15(12-29)25(30)35(17-6-3-7-18(36)23(17)22)26-33-34-27(41-26)40-13-21(37)32-16-5-4-10-31-24(16)28/h4-5,8-11,22H,3,6-7,13,30H2,1-2H3,(H,32,37) |
| InChIKey | PFJWJZXOJGXLPU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.12 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|