C29H28N6O5S2 — CID 23858100
2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide (PubChem CID 23858100) has the molecular formula C29H28N6O5S2 and a molecular weight of 604.71 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23858100 |
| Molecular Formula | C29H28N6O5S2 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CSc1nnc(N2C(N)=C(C#N)C(c3ccc(OC)c(OC)c3)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C29H28N6O5S2/c1-38-21-10-5-4-7-18(21)32-24(37)15-41-29-34-33-28(42-29)35-19-8-6-9-20(36)26(19)25(17(14-30)27(35)31)16-11-12-22(39-2)23(13-16)40-3/h4-5,7,10-13,25H,6,8-9,15,31H2,1-3H3,(H,32,37) |
| InChIKey | VXWZGNZJFFQOLE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |