C28H25ClN6O3S2 — CID 23997594
2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 23997594) has the molecular formula C28H25ClN6O3S2 and a molecular weight of 593.13 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23997594 |
| Molecular Formula | C28H25ClN6O3S2 |
| Molecular Weight | 593.13 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nnc(N2C(N)=C(C#N)C(c3ccc(C)cc3)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C28H25ClN6O3S2/c1-15-6-8-16(9-7-15)24-18(13-30)26(31)35(20-4-3-5-21(36)25(20)24)27-33-34-28(40-27)39-14-23(37)32-19-12-17(29)10-11-22(19)38-2/h6-12,24H,3-5,14,31H2,1-2H3,(H,32,37) |
| InChIKey | LJDLEARWCNVFIB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.13 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |