C26H22N6O4S3 — CID 23885798
4-[[2-[[5-[2-amino-3-cyano-4-(3-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid (PubChem CID 23885798) has the molecular formula C26H22N6O4S3 and a molecular weight of 578.70 g/mol. Its IUPAC name is 4-[[2-[[5-[2-amino-3-cyano-4-(3-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[5-[2-amino-3-cyano-4-(3-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23885798 |
| Molecular Formula | C26H22N6O4S3 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | 4-[[2-[[5-[2-amino-3-cyano-4-(3-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid |
| SMILES | Cc1ccsc1C1C(C#N)=C(N)N(c2nnc(SCC(=O)Nc3ccc(C(=O)O)cc3)s2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C26H22N6O4S3/c1-13-9-10-37-22(13)20-16(11-27)23(28)32(17-3-2-4-18(33)21(17)20)25-30-31-26(39-25)38-12-19(34)29-15-7-5-14(6-8-15)24(35)36/h5-10,20H,2-4,12,28H2,1H3,(H,29,34)(H,35,36) |
| InChIKey | HXCMQCQMDNSEDN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |