C29H27N5O5S2 — CID 23913916
2-amino-5-oxo-1-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 23913916) has the molecular formula C29H27N5O5S2 and a molecular weight of 589.70 g/mol. Its IUPAC name is 2-amino-5-oxo-1-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-5-oxo-1-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23913916 |
| Molecular Formula | C29H27N5O5S2 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | 2-amino-5-oxo-1-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | COc1cc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)c4ccccc4)s3)C3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C29H27N5O5S2/c1-37-22-12-17(13-23(38-2)26(22)39-3)24-18(14-30)27(31)34(19-10-7-11-20(35)25(19)24)28-32-33-29(41-28)40-15-21(36)16-8-5-4-6-9-16/h4-6,8-9,12-13,24H,7,10-11,15,31H2,1-3H3 |
| InChIKey | VZSUVFVBWJLSOS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 140.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |