C21H20N6O2S2 — CID 23771589
2-[[5-[2-amino-3-cyano-4-(3-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 23771589) has the molecular formula C21H20N6O2S2 and a molecular weight of 452.57 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(3-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(3-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 23771589 |
| Molecular Formula | C21H20N6O2S2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(3-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(C2C(C#N)=C(N)N(c3nnc(SCC(N)=O)s3)C3=C2C(=O)CCC3)c1 |
| InChI | InChI=1S/C21H20N6O2S2/c1-11-4-2-5-12(8-11)17-13(9-22)19(24)27(14-6-3-7-15(28)18(14)17)20-25-26-21(31-20)30-10-16(23)29/h2,4-5,8,17H,3,6-7,10,24H2,1H3,(H2,23,29) |
| InChIKey | STQUVIFKJYZJHO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |