C24H25N5O5S2 — CID 23997481
ethyl 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 23997481) has the molecular formula C24H25N5O5S2 and a molecular weight of 527.63 g/mol. Its IUPAC name is ethyl 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 23997481 |
| Molecular Formula | C24H25N5O5S2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | ethyl 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(N2C(N)=C(C#N)C(c3cc(OC)ccc3OC)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C24H25N5O5S2/c1-4-34-19(31)12-35-24-28-27-23(36-24)29-16-6-5-7-17(30)21(16)20(15(11-25)22(29)26)14-10-13(32-2)8-9-18(14)33-3/h8-10,20H,4-7,12,26H2,1-3H3 |
| InChIKey | BUPDSFRZJDIQQF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 140.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |