C29H29N7O4S3 — CID 25043579
2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 25043579) has the molecular formula C29H29N7O4S3 and a molecular weight of 635.80 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 25043579 |
| Molecular Formula | C29H29N7O4S3 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1C1C(C#N)=C(N)N(c2nnc(SCC(=O)NCCc3ccc(S(N)(=O)=O)cc3)s2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C29H29N7O4S3/c1-17-5-2-3-6-20(17)25-21(15-30)27(31)36(22-7-4-8-23(37)26(22)25)28-34-35-29(42-28)41-16-24(38)33-14-13-18-9-11-19(12-10-18)43(32,39)40/h2-3,5-6,9-12,25H,4,7-8,13-14,16,31H2,1H3,(H,33,38)(H2,32,39,40) |
| InChIKey | VSFPUNFEHIJWNR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 185.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |