C26H22ClN5OS2 — CID 25301032
(4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 25301032) has the molecular formula C26H22ClN5OS2 and a molecular weight of 520.08 g/mol. Its IUPAC name is (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 25301032 |
| Molecular Formula | C26H22ClN5OS2 |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1ccccc1[C@H]1C(C#N)=C(N)N(c2nnc(SCc3ccccc3Cl)s2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C26H22ClN5OS2/c1-15-7-2-4-9-17(15)22-18(13-28)24(29)32(20-11-6-12-21(33)23(20)22)25-30-31-26(35-25)34-14-16-8-3-5-10-19(16)27/h2-5,7-10,22H,6,11-12,14,29H2,1H3/t22-/m0/s1 |
| InChIKey | NGYNHHHATQSLFB-QFIPXVFZSA-N |
| XLogP | 6.10 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |