C28H27N5OS2 — CID 23857996
2-amino-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxo-4-(4-propan-2-ylphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 23857996) has the molecular formula C28H27N5OS2 and a molecular weight of 513.69 g/mol. Its IUPAC name is 2-amino-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxo-4-(4-propan-2-ylphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxo-4-(4-propan-2-ylphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23857996 |
| Molecular Formula | C28H27N5OS2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-amino-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxo-4-(4-propan-2-ylphenyl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC(C)c1ccc(C2C(C#N)=C(N)N(c3nnc(SCc4ccccc4)s3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C28H27N5OS2/c1-17(2)19-11-13-20(14-12-19)24-21(15-29)26(30)33(22-9-6-10-23(34)25(22)24)27-31-32-28(36-27)35-16-18-7-4-3-5-8-18/h3-5,7-8,11-14,17,24H,6,9-10,16,30H2,1-2H3 |
| InChIKey | UTFGMUBPNXWRDT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |