C21H19Cl2N5OS2 — CID 23829871
2-amino-4-(3,4-dichlorophenyl)-5-oxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 23829871) has the molecular formula C21H19Cl2N5OS2 and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-amino-4-(3,4-dichlorophenyl)-5-oxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(3,4-dichlorophenyl)-5-oxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23829871 |
| Molecular Formula | C21H19Cl2N5OS2 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 2-amino-4-(3,4-dichlorophenyl)-5-oxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC(C)Sc1nnc(N2C(N)=C(C#N)C(c3ccc(Cl)c(Cl)c3)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C21H19Cl2N5OS2/c1-10(2)30-21-27-26-20(31-21)28-15-4-3-5-16(29)18(15)17(12(9-24)19(28)25)11-6-7-13(22)14(23)8-11/h6-8,10,17H,3-5,25H2,1-2H3 |
| InChIKey | KPJNZJAUSSZRGG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |