C23H18ClN5OS3 — CID 42558849
(4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 42558849) has the molecular formula C23H18ClN5OS3 and a molecular weight of 512.09 g/mol. Its IUPAC name is (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 42558849 |
| Molecular Formula | C23H18ClN5OS3 |
| Molecular Weight | 512.09 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(N)N(c2nnc(SCc3ccccc3Cl)s2)C2=C(C(=O)CCC2)[C@H]1c1ccsc1 |
| InChI | InChI=1S/C23H18ClN5OS3/c24-16-5-2-1-4-13(16)12-32-23-28-27-22(33-23)29-17-6-3-7-18(30)20(17)19(14-8-9-31-11-14)15(10-25)21(29)26/h1-2,4-5,8-9,11,19H,3,6-7,12,26H2/t19-/m0/s1 |
| InChIKey | YBAPPQAEUQMOPS-IBGZPJMESA-N |
| XLogP | 5.85 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.09 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |