C24H19ClN6OS2 — CID 42558847
(4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 42558847) has the molecular formula C24H19ClN6OS2 and a molecular weight of 507.04 g/mol. Its IUPAC name is (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 42558847 |
| Molecular Formula | C24H19ClN6OS2 |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (4S)-2-amino-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(N)N(c2nnc(SCc3ccccc3Cl)s2)C2=C(C(=O)CCC2)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C24H19ClN6OS2/c25-17-7-2-1-5-15(17)13-33-24-30-29-23(34-24)31-18-8-3-9-19(32)21(18)20(16(11-26)22(31)27)14-6-4-10-28-12-14/h1-2,4-7,10,12,20H,3,8-9,13,27H2/t20-/m0/s1 |
| InChIKey | FQEARZWSNZKDQW-FQEVSTJZSA-N |
| XLogP | 5.18 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |