C25H22ClN3O2S2 — CID 4597453
1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 4597453) has the molecular formula C25H22ClN3O2S2 and a molecular weight of 496.06 g/mol. Its IUPAC name is 1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | 1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 4597453 |
| Molecular Formula | C25H22ClN3O2S2 |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-(2-methylphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | Cc1ccccc1C1CC(=O)N(c2nnc(SCc3ccccc3Cl)s2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C25H22ClN3O2S2/c1-15-7-2-4-9-17(15)18-13-22(31)29(20-11-6-12-21(30)23(18)20)24-27-28-25(33-24)32-14-16-8-3-5-10-19(16)26/h2-5,7-10,18H,6,11-14H2,1H3 |
| InChIKey | IGMCCZALCNFLJU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|