C19H18FN3O2S2 — CID 3502753
1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-fluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 3502753) has the molecular formula C19H18FN3O2S2 and a molecular weight of 403.50 g/mol. Its IUPAC name is 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-fluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-fluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 3502753 |
| Molecular Formula | C19H18FN3O2S2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-fluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | CCSc1nnc(N2C(=O)CC(c3ccc(F)cc3)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C19H18FN3O2S2/c1-2-26-19-22-21-18(27-19)23-14-4-3-5-15(24)17(14)13(10-16(23)25)11-6-8-12(20)9-7-11/h6-9,13H,2-5,10H2,1H3 |
| InChIKey | WRPXTMXNGOJXBO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|