C22H25N3O2S2 — CID 3879441
7,7-dimethyl-4-phenyl-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 3879441) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is 7,7-dimethyl-4-phenyl-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 7,7-dimethyl-4-phenyl-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 3879441 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 7,7-dimethyl-4-phenyl-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | CCCSc1nnc(N2C(=O)CC(c3ccccc3)C3=C2CC(C)(C)CC3=O)s1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-4-10-28-21-24-23-20(29-21)25-16-12-22(2,3)13-17(26)19(16)15(11-18(25)27)14-8-6-5-7-9-14/h5-9,15H,4,10-13H2,1-3H3 |
| InChIKey | NLIFCNUNWPYLPG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|