C20H21N3O2S3 — CID 4916399
7,7-dimethyl-1-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 4916399) has the molecular formula C20H21N3O2S3 and a molecular weight of 431.61 g/mol. Its IUPAC name is 7,7-dimethyl-1-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 7,7-dimethyl-1-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 4916399 |
| Molecular Formula | C20H21N3O2S3 |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 7,7-dimethyl-1-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | C=CCSc1nnc(N2C(=O)CC(c3ccsc3)C3=C2CC(C)(C)CC3=O)s1 |
| InChI | InChI=1S/C20H21N3O2S3/c1-4-6-27-19-22-21-18(28-19)23-14-9-20(2,3)10-15(24)17(14)13(8-16(23)25)12-5-7-26-11-12/h4-5,7,11,13H,1,6,8-10H2,2-3H3 |
| InChIKey | UFQDBJPXIVEBOS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|