C27H21ClFN7O4S2 — CID 23914013
2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 23914013) has the molecular formula C27H21ClFN7O4S2 and a molecular weight of 626.10 g/mol. Its IUPAC name is 2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23914013 |
| Molecular Formula | C27H21ClFN7O4S2 |
| Molecular Weight | 626.10 g/mol |
| Exact Mass | 625.08 |
| IUPAC Name | 2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(N3C(N)=C(C#N)C(c4c(F)cccc4Cl)C4=C3CCCC4=O)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21ClFN7O4S2/c1-13-8-9-14(10-19(13)36(39)40)32-21(38)12-41-27-34-33-26(42-27)35-18-6-3-7-20(37)24(18)22(15(11-30)25(35)31)23-16(28)4-2-5-17(23)29/h2,4-5,8-10,22H,3,6-7,12,31H2,1H3,(H,32,38) |
| InChIKey | WMRILHPHKWGCHN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 168.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.10 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|