C22H19ClFN5O3S2 — CID 23913821
ethyl 2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 23913821) has the molecular formula C22H19ClFN5O3S2 and a molecular weight of 520.01 g/mol. Its IUPAC name is ethyl 2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 23913821 |
| Molecular Formula | C22H19ClFN5O3S2 |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | ethyl 2-[[5-[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(N2C(N)=C(C#N)C(c3c(F)cccc3Cl)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C22H19ClFN5O3S2/c1-2-32-16(31)10-33-22-28-27-21(34-22)29-14-7-4-8-15(30)19(14)17(11(9-25)20(29)26)18-12(23)5-3-6-13(18)24/h3,5-6,17H,2,4,7-8,10,26H2,1H3 |
| InChIKey | CTTGCZIOXHHZCB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |