C21H19F2NO2S — CID 1266607
(4S)-1-(2,4-difluorophenyl)-7,7-dimethyl-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 1266607) has the molecular formula C21H19F2NO2S and a molecular weight of 387.45 g/mol. Its IUPAC name is (4S)-1-(2,4-difluorophenyl)-7,7-dimethyl-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | (4S)-1-(2,4-difluorophenyl)-7,7-dimethyl-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 1266607 |
| Molecular Formula | C21H19F2NO2S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (4S)-1-(2,4-difluorophenyl)-7,7-dimethyl-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(F)cc1F)C(=O)C[C@@H]2c1cccs1 |
| InChI | InChI=1S/C21H19F2NO2S/c1-21(2)10-16-20(17(25)11-21)13(18-4-3-7-27-18)9-19(26)24(16)15-6-5-12(22)8-14(15)23/h3-8,13H,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | HJVAGIZBGKWNIS-CYBMUJFWSA-N |
| XLogP | 5.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |