C25H26FNO4 — CID 6496604
4-(2,3-dimethoxyphenyl)-1-(2-fluorophenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 6496604) has the molecular formula C25H26FNO4 and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)-1-(2-fluorophenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 4-(2,3-dimethoxyphenyl)-1-(2-fluorophenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 6496604 |
| Molecular Formula | C25H26FNO4 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)-1-(2-fluorophenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | COc1cccc(C2CC(=O)N(c3ccccc3F)C3=C2C(=O)CC(C)(C)C3)c1OC |
| InChI | InChI=1S/C25H26FNO4/c1-25(2)13-19-23(20(28)14-25)16(15-8-7-11-21(30-3)24(15)31-4)12-22(29)27(19)18-10-6-5-9-17(18)26/h5-11,16H,12-14H2,1-4H3 |
| InChIKey | XDSPHNNPKCQHOI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |