C28H33NO4 — CID 23831120
4-(2,3-dimethoxyphenyl)-7,7-dimethyl-1-(4-propan-2-ylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 23831120) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)-7,7-dimethyl-1-(4-propan-2-ylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 4-(2,3-dimethoxyphenyl)-7,7-dimethyl-1-(4-propan-2-ylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 23831120 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)-7,7-dimethyl-1-(4-propan-2-ylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | COc1cccc(C2CC(=O)N(c3ccc(C(C)C)cc3)C3=C2C(=O)CC(C)(C)C3)c1OC |
| InChI | InChI=1S/C28H33NO4/c1-17(2)18-10-12-19(13-11-18)29-22-15-28(3,4)16-23(30)26(22)21(14-25(29)31)20-8-7-9-24(32-5)27(20)33-6/h7-13,17,21H,14-16H2,1-6H3 |
| InChIKey | AMCGIURJJPGGCW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |