C23H21Cl2NO2 — CID 1266585
(4R)-4-(2,4-dichlorophenyl)-7,7-dimethyl-1-phenyl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 1266585) has the molecular formula C23H21Cl2NO2 and a molecular weight of 414.33 g/mol. Its IUPAC name is (4R)-4-(2,4-dichlorophenyl)-7,7-dimethyl-1-phenyl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | (4R)-4-(2,4-dichlorophenyl)-7,7-dimethyl-1-phenyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 1266585 |
| Molecular Formula | C23H21Cl2NO2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (4R)-4-(2,4-dichlorophenyl)-7,7-dimethyl-1-phenyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccccc1)C(=O)C[C@H]2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H21Cl2NO2/c1-23(2)12-19-22(20(27)13-23)17(16-9-8-14(24)10-18(16)25)11-21(28)26(19)15-6-4-3-5-7-15/h3-10,17H,11-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | IHAQGWVTJJYCMI-KRWDZBQOSA-N |
| XLogP | 6.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |