C25H24Cl2N2O3 — CID 23999053
N-[4-[4-(2,3-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]phenyl]acetamide (PubChem CID 23999053) has the molecular formula C25H24Cl2N2O3 and a molecular weight of 471.38 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 23999053 |
| Molecular Formula | C25H24Cl2N2O3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(c3cccc(Cl)c3Cl)C3=C2CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O3/c1-14(30)28-15-7-9-16(10-8-15)29-20-12-25(2,3)13-21(31)23(20)18(11-22(29)32)17-5-4-6-19(26)24(17)27/h4-10,18H,11-13H2,1-3H3,(H,28,30) |
| InChIKey | VHWBVMMVNIUEPX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |