C23H22Cl2N2O4S — CID 25044981
4-[4-(2,4-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide (PubChem CID 25044981) has the molecular formula C23H22Cl2N2O4S and a molecular weight of 493.41 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(2,4-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25044981 |
| Molecular Formula | C23H22Cl2N2O4S |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(S(N)(=O)=O)cc1)C(=O)CC2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O4S/c1-23(2)11-19-22(20(28)12-23)17(16-8-3-13(24)9-18(16)25)10-21(29)27(19)14-4-6-15(7-5-14)32(26,30)31/h3-9,17H,10-12H2,1-2H3,(H2,26,30,31) |
| InChIKey | UEQGPSYZGZXQFB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |