C25H26ClNO2 — CID 23915330
4-(3-chlorophenyl)-1-(2,6-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 23915330) has the molecular formula C25H26ClNO2 and a molecular weight of 407.94 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1-(2,6-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 4-(3-chlorophenyl)-1-(2,6-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 23915330 |
| Molecular Formula | C25H26ClNO2 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-(3-chlorophenyl)-1-(2,6-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | Cc1cccc(C)c1N1C(=O)CC(c2cccc(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C25H26ClNO2/c1-15-7-5-8-16(2)24(15)27-20-13-25(3,4)14-21(28)23(20)19(12-22(27)29)17-9-6-10-18(26)11-17/h5-11,19H,12-14H2,1-4H3 |
| InChIKey | RPEOXYGACOXRFX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |