C24H24N2O4 — CID 4540355
7,7-dimethyl-1-(4-methylphenyl)-4-(3-nitrophenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 4540355) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 7,7-dimethyl-1-(4-methylphenyl)-4-(3-nitrophenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 7,7-dimethyl-1-(4-methylphenyl)-4-(3-nitrophenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 4540355 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 7,7-dimethyl-1-(4-methylphenyl)-4-(3-nitrophenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CC(c3cccc([N+](=O)[O-])c3)C3=C2CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-15-7-9-17(10-8-15)25-20-13-24(2,3)14-21(27)23(20)19(12-22(25)28)16-5-4-6-18(11-16)26(29)30/h4-11,19H,12-14H2,1-3H3 |
| InChIKey | ZPMNCZZOKKEZMU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|