C26H29NO2 — CID 23999086
1-(2,5-dimethylphenyl)-7,7-dimethyl-4-(3-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 23999086) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-7,7-dimethyl-4-(3-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 1-(2,5-dimethylphenyl)-7,7-dimethyl-4-(3-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 23999086 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-7,7-dimethyl-4-(3-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | Cc1cccc(C2CC(=O)N(c3cc(C)ccc3C)C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C26H29NO2/c1-16-7-6-8-19(11-16)20-13-24(29)27(21-12-17(2)9-10-18(21)3)22-14-26(4,5)15-23(28)25(20)22/h6-12,20H,13-15H2,1-5H3 |
| InChIKey | FUZZCRRFDPPESH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |