C29H32N2O2S — CID 5294736
2-[7,7-dimethyl-4-(3-methylphenyl)-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile (PubChem CID 5294736) has the molecular formula C29H32N2O2S and a molecular weight of 472.65 g/mol. Its IUPAC name is 2-[7,7-dimethyl-4-(3-methylphenyl)-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile.
| Compound Name | 2-[7,7-dimethyl-4-(3-methylphenyl)-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 5294736 |
| Molecular Formula | C29H32N2O2S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[7,7-dimethyl-4-(3-methylphenyl)-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile |
| SMILES | Cc1cccc(C2CC(=O)N(c3sc4c(c3C#N)CCCCCC4)C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C29H32N2O2S/c1-18-9-8-10-19(13-18)21-14-26(33)31(23-15-29(2,3)16-24(32)27(21)23)28-22(17-30)20-11-6-4-5-7-12-25(20)34-28/h8-10,13,21H,4-7,11-12,14-16H2,1-3H3 |
| InChIKey | FUIZVHNIOPFDOC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |