C29H30N2O3S — CID 42578918
2-[(4S)-7,7-dimethyl-2,5-dioxo-4-(4-prop-2-enoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 42578918) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[(4S)-7,7-dimethyl-2,5-dioxo-4-(4-prop-2-enoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[(4S)-7,7-dimethyl-2,5-dioxo-4-(4-prop-2-enoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 42578918 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-[(4S)-7,7-dimethyl-2,5-dioxo-4-(4-prop-2-enoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | C=CCOc1ccc([C@@H]2CC(=O)N(c3sc4c(c3C#N)CCCC4)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C29H30N2O3S/c1-4-13-34-19-11-9-18(10-12-19)21-14-26(33)31(23-15-29(2,3)16-24(32)27(21)23)28-22(17-30)20-7-5-6-8-25(20)35-28/h4,9-12,21H,1,5-8,13-16H2,2-3H3/t21-/m0/s1 |
| InChIKey | ZSRNHKGPQAZTDN-NRFANRHFSA-N |
| XLogP | 6.23 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|