C28H29FN2O2S — CID 42578931
2-[(4R)-4-(4-fluorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile (PubChem CID 42578931) has the molecular formula C28H29FN2O2S and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[(4R)-4-(4-fluorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile.
| Compound Name | 2-[(4R)-4-(4-fluorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 42578931 |
| Molecular Formula | C28H29FN2O2S |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-[(4R)-4-(4-fluorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1sc3c(c1C#N)CCCCCC3)C(=O)C[C@@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C28H29FN2O2S/c1-28(2)14-22-26(23(32)15-28)20(17-9-11-18(29)12-10-17)13-25(33)31(22)27-21(16-30)19-7-5-3-4-6-8-24(19)34-27/h9-12,20H,3-8,13-15H2,1-2H3/t20-/m1/s1 |
| InChIKey | ZNHZFSOCLCHLPM-HXUWFJFHSA-N |
| XLogP | 6.58 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |