C28H30N2O3S — CID 5294985
2-[4-(2-methoxyphenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile (PubChem CID 5294985) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile.
| Compound Name | 2-[4-(2-methoxyphenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 5294985 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile |
| SMILES | COc1ccccc1C1CC(=O)N(c2sc3c(c2C#N)CCCCC3)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C28H30N2O3S/c1-28(2)14-21-26(22(31)15-28)19(17-9-7-8-11-23(17)33-3)13-25(32)30(21)27-20(16-29)18-10-5-4-6-12-24(18)34-27/h7-9,11,19H,4-6,10,12-15H2,1-3H3 |
| InChIKey | MSOUBYRSXHKDLJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |