C27H27ClN2O2S — CID 42578927
2-[(4R)-4-(3-chlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile (PubChem CID 42578927) has the molecular formula C27H27ClN2O2S and a molecular weight of 479.05 g/mol. Its IUPAC name is 2-[(4R)-4-(3-chlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile.
| Compound Name | 2-[(4R)-4-(3-chlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 42578927 |
| Molecular Formula | C27H27ClN2O2S |
| Molecular Weight | 479.05 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[(4R)-4-(3-chlorophenyl)-7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1sc3c(c1C#N)CCCCC3)C(=O)C[C@@H]2c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H27ClN2O2S/c1-27(2)13-21-25(22(31)14-27)19(16-7-6-8-17(28)11-16)12-24(32)30(21)26-20(15-29)18-9-4-3-5-10-23(18)33-26/h6-8,11,19H,3-5,9-10,12-14H2,1-2H3/t19-/m1/s1 |
| InChIKey | RIKASQCFCPYGCU-LJQANCHMSA-N |
| XLogP | 6.71 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.05 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |